logo
Home  > 6-O-Methyl-2',4''-bis-O-(trimethylsilyl)-9-[O-(1-ethoxy-1-methylethyl)oxime]-Erythromycin

AA32767

119665-62-2 | 6-O-Methyl-2',4''-bis-O-(trimethylsilyl)-9-[O-(1-ethoxy-1-methylethyl)oxime]-Erythromycin

Packsize Purity Availability Price Discounted Price    Quantity
500mg 95% 1 week $1,685.00 $1,180.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA32767
Chemical Name: 6-O-Methyl-2',4''-bis-O-(trimethylsilyl)-9-[O-(1-ethoxy-1-methylethyl)oxime]-Erythromycin
CAS Number: 119665-62-2
Molecular Formula: C49H96N2O14Si2
Molecular Weight: 993.4625
MDL Number: MFCD09263749
SMILES: CCOC(O/N=C/1[C@H](C)C[C@@](C)(OC)[C@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O[Si](C)(C)C)N(C)C)[C@@H](C)[C@H](O[C@@H]2O[C@@H](C)[C@@H]([C@](C2)(C)OC)O[Si](C)(C)C)[C@H](C(=O)O[C@@H]([C@@]([C@@H]([C@H]1C)O)(C)O)CC)C)(C)C

 

Upstream Synthesis Route
  • 6-O-Methyl-2',4''-bis-O-(trimethylsilyl)-9-[O-(1-ethoxy-1-methylethyl)oxime]-Erythromycin is a versatile compound commonly utilized in chemical synthesis. This specific derivative of Erythromycin plays a crucial role in organic chemistry as a protecting group strategy, primarily in the modification of sensitive functional groups during complex molecule synthesis. By selectively masking reactive moieties within a molecule, this compound enables precise control over chemical reactions, ensuring the desired synthetic pathway is achieved without unwanted side reactions. This application is particularly valuable in the synthesis of intricate natural products and pharmaceutical compounds where precise manipulation of functional groups is essential for success.
FEATURED PRODUCTS