AA32812
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | in stock | $106.00 | $75.00 | - + | |
100mg | 95% | in stock | $140.00 | $98.00 | - + | |
250mg | 95% | in stock | $224.00 | $157.00 | - + | |
500mg | 95% | in stock | $372.00 | $260.00 | - + | |
1g | 95% | in stock | $559.00 | $391.00 | - + | |
5g | 95% | in stock | $1,674.00 | $1,172.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA32812 |
Chemical Name: | cis-4-(Aminomethyl)cyclohexanecarboxylic acid |
CAS Number: | 1197-17-7 |
Molecular Formula: | C8H15NO2 |
Molecular Weight: | 157.2102 |
MDL Number: | MFCD19706018 |
SMILES: | NC[C@@H]1CC[C@@H](CC1)C(=O)O |
The cis-4-(Aminomethyl)cyclohexanecarboxylic acid is a versatile compound widely used in chemical synthesis for its unique structural properties and functional groups. It serves as a key building block in the production of various pharmaceuticals, agrochemicals, and fine chemicals due to its ability to participate in a range of important synthetic transformations.In chemical synthesis, cis-4-(Aminomethyl)cyclohexanecarboxylic acid plays a crucial role as a chiral auxiliary in asymmetric synthesis. Its cyclohexane ring provides a rigid framework that can influence the stereochemistry of reactions, leading to the selective formation of stereoisomers. This property is particularly valuable in the synthesis of complex organic molecules where stereochemical control is essential.Additionally, the amino and carboxylic acid functionalities of cis-4-(Aminomethyl)cyclohexanecarboxylic acid enable it to serve as a versatile intermediate in the preparation of various functionalized compounds. These functional groups can undergo diverse chemical reactions such as amide formation, esterification, and condensation, allowing for the rapid construction of diverse molecular structures.Moreover, cis-4-(Aminomethyl)cyclohexanecarboxylic acid can be utilized in the synthesis of peptidomimetics and pharmaceuticals where its amino group can serve as a key moiety for bioactivity or binding interactions. Its presence in the molecular framework can enhance the pharmacological properties of the final compounds, making it a valuable component in drug discovery and development processes.Overall, the application of cis-4-(Aminomethyl)cyclohexanecarboxylic acid in chemical synthesis is instrumental in enabling the efficient and selective construction of complex molecules with specific stereochemical and functional characteristics. Its versatile nature and unique reactivity make it a valuable tool for synthetic chemists in the design and creation of novel compounds for various industrial and research applications.