AA32845
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $28.00 | $20.00 | - + | |
1g | 95% | in stock | $85.00 | $59.00 | - + | |
5g | 95% | in stock | $282.00 | $198.00 | - + | |
25g | 95% | in stock | $1,039.00 | $727.00 | - + | |
100g | 95% | in stock | $3,651.00 | $2,556.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA32845 |
Chemical Name: | 3-(N-Methylaminocarbonyl)phenylboronic acid, pinacol ester |
CAS Number: | 1197171-76-8 |
Molecular Formula: | C14H20BNO3 |
Molecular Weight: | 261.1245 |
MDL Number: | MFCD17015821 |
SMILES: | CNC(=O)c1cccc(c1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 341 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
N-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is a versatile compound widely used in chemical synthesis as a key building block. Its unique structure allows for efficient incorporation into various organic molecules, making it a valuable tool for synthetic chemists. This compound acts as a reliable source of both the N-methyl group and boron functionality, enabling the introduction of these moieties in a controlled and selective manner. The presence of the N-methyl group enhances the compound's reactivity and enables it to participate in a wide range of synthetic transformations, while the boron-containing dioxaborolane moiety provides a handle for further functionalization. In chemical synthesis, N-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide serves as a versatile intermediate for the construction of complex organic molecules with high efficiency and precision.