AE10371
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $23.00 | $17.00 | - + | |
5mg | 98% | in stock | $81.00 | $57.00 | - + | |
10mg | 98% | in stock | $121.00 | $85.00 | - + | |
25mg | 98% | in stock | $203.00 | $142.00 | - + | |
50mg | 98% | in stock | $344.00 | $241.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10371 |
Chemical Name: | UNC0224 |
CAS Number: | 1197196-48-7 |
Molecular Formula: | C26H43N7O2 |
Molecular Weight: | 485.6653 |
MDL Number: | MFCD18251564 |
SMILES: | COc1cc2c(cc1OCCCN(C)C)nc(nc2NC1CCN(CC1)C)N1CCCN(CC1)C |
Complexity: | 619 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 9 |
XLogP3: | 3.4 |
European journal of medicinal chemistry 20121001
Journal of medicinal chemistry 20110908
Journal of medicinal chemistry 20100812
Journal of medicinal chemistry 20091224