logo
Home  > Benzoic acid, 4-(10,15,20-triphenyl-21H,23H-porphin-5-yl)-, methyl ester

AA32940

119730-06-2 | Benzoic acid, 4-(10,15,20-triphenyl-21H,23H-porphin-5-yl)-, methyl ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg >90% in stock $180.00 $126.00 -   +
250mg >90% in stock $407.00 $285.00 -   +
1g >90.0%(HPLC) in stock $864.00 $605.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA32940
Chemical Name: Benzoic acid, 4-(10,15,20-triphenyl-21H,23H-porphin-5-yl)-, methyl ester
CAS Number: 119730-06-2
Molecular Formula: C46H32N4O2
Molecular Weight: 672.7719
MDL Number: MFCD02093480
SMILES: COC(=O)c1ccc(cc1)C1=C2C=CC(=N2)C(=c2ccc(=C(C3=NC(=C(c4[nH]c1cc4)c1ccccc1)C=C3)c1ccccc1)[nH]2)c1ccccc1

 

Upstream Synthesis Route 
  • 5-(4-Methoxycarbonylphenyl)-10,15,20-triphenylporphyrin plays a crucial role in chemical synthesis as a versatile building block and catalyst. Its unique molecular structure allows it to participate in a wide range of synthetic transformations, enabling the formation of complex molecular architectures. In organic synthesis, this compound is utilized for the construction of functional materials, such as polymers and dendrimers, through selective reactions and efficient transformations. Additionally, 5-(4-Methoxycarbonylphenyl)-10,15,20-triphenylporphyrin serves as a catalyst in various organic reactions, including oxidation and hydrogenation processes, leading to high yields and selectivity. Its applications extend to the development of new methodologies in synthetic chemistry, making it a valuable tool for the creation of novel compounds with diverse chemical properties.
FEATURED PRODUCTS