logo
Home  > Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate

AA33051

119798-44-6 | Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $148.00 $104.00 -   +
5mg 95% in stock $691.00 $484.00 -   +
10mg 95% in stock $1,149.00 $804.00 -   +
100mg 95% in stock $1,638.00 $1,146.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA33051
Chemical Name: Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate
CAS Number: 119798-44-6
Molecular Formula: C20H32O2
Molecular Weight: 304.46688000000006
MDL Number: MFCD01711183
SMILES: CCC=CCC=CCC=CCC=CCCCCC(=O)OCC

 

Upstream Synthesis Route
  • Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate is a vital compound in chemical synthesis, revered for its distinct properties and versatile applications. Within the realm of chemistry, this compound is valued for its role as a key intermediate in the synthesis of various organic molecules. Its unique structure makes it an essential building block for creating complex structures and functional groups, particularly in the development of pharmaceuticals, agrochemicals, and fragrances.One of the primary applications of Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate lies in its involvement in the creation of lipids and fatty acids, where it serves as a precursor for the production of essential fatty acids. Additionally, this compound plays a crucial role in the synthesis of bioactive compounds and lipid derivatives, contributing to the development of innovative pharmaceuticals and bioactive substances.Furthermore, Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate is utilized in the preparation of functionalized molecules for various industrial applications, including lubricants, emollients, and surfactants. Its ability to undergo diverse chemical transformations enables the generation of a wide range of derivatives with tailored properties, making it a valuable tool in the field of chemical synthesis.Overall, Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate holds significant importance in chemical synthesis, offering researchers and chemists a versatile compound for creating intricate organic structures and developing innovative molecules for different industrial sectors.
FEATURED PRODUCTS