AA33074
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $203.00 | $142.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33074 |
Chemical Name: | (R)-3-Benzyl-4-methoxy-4-oxobutanoic acid |
CAS Number: | 119807-84-0 |
Molecular Formula: | C12H14O4 |
Molecular Weight: | 222.2372 |
MDL Number: | MFCD00211258 |
SMILES: | COC(=O)[C@H](Cc1ccccc1)CC(=O)O |
(R)-3-Benzyl-4-methoxy-4-oxobutanoic acid, also known as $name$, is a valuable compound widely used in chemical synthesis processes. This compound is particularly noted for its role as a versatile building block in organic chemistry. Its unique structure and reactivity make it a key intermediate in the synthesis of various pharmaceuticals, natural products, and fine chemicals.One notable application of (R)-3-Benzyl-4-methoxy-4-oxobutanoic acid is in the asymmetric synthesis of biologically active molecules. As a chiral compound, its enantiomeric purity is crucial in controlling the stereochemistry of the final product. By utilizing this compound as a chiral auxiliary or a starting material in asymmetric transformations, chemists can achieve high levels of stereoselectivity, leading to the production of single enantiomer products with enhanced biological activity.Additionally, (R)-3-Benzyl-4-methoxy-4-oxobutanoic acid can serve as a key component in the construction of complex molecular scaffolds. Through strategic functional group manipulations and selective reactions, chemists can exploit the unique reactivity of this compound to introduce specific structural motifs into target molecules. This enables the synthesis of diverse chemical entities with tailored properties and functionalities for various applications in drug discovery, materials science, and chemical biology.Overall, (R)-3-Benzyl-4-methoxy-4-oxobutanoic acid plays a crucial role in advancing the field of chemical synthesis by enabling the efficient construction of complex molecules with high structural and stereochemical control. Its versatility and synthetic utility make it a valuable tool for chemists seeking to access novel compounds and develop innovative solutions in the realm of organic chemistry.