AE25151
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $299.00 | $209.00 | - + | |
250mg | 95% | in stock | $573.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE25151 |
Chemical Name: | (E)-Methyl 3-(2-chloro-5-methylpyridin-3-yl)-acrylate |
CAS Number: | 1198401-58-9 |
Molecular Formula: | C10H10ClNO2 |
Molecular Weight: | 211.6449 |
MDL Number: | MFCD13563056 |
SMILES: | COC(=O)/C=C/c1cc(C)cnc1Cl |
Complexity: | 230 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.5 |
European journal of medicinal chemistry 20091101