AV73698
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $467.00 | $327.00 | - + | |
250mg | 97% | in stock | $852.00 | $596.00 | - + | |
500mg | 97% | in stock | $1,283.00 | $899.00 | - + | |
1g | 97% | in stock | $1,947.00 | $1,363.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV73698 |
Chemical Name: | 1H-PYRROLE-2,5-DICARBOXYLIC ACID, MONOMETHYL ESTER |
CAS Number: | 1199-64-0 |
Molecular Formula: | C7H7NO4 |
Molecular Weight: | 169.1348 |
MDL Number: | MFCD12402324 |
SMILES: | COC(=O)c1ccc([nH]1)C(=O)O |
5-(Methoxycarbonyl)-1H-pyrrole-2-carboxylic acid is a versatile compound used in a wide range of chemical synthesis applications. This compound serves as a key building block in the preparation of various pharmaceuticals, agrochemicals, and organic materials. Its functional groups enable it to participate in a variety of chemical reactions, making it highly valuable in organic synthesis.One common application of 5-(Methoxycarbonyl)-1H-pyrrole-2-carboxylic acid is in the synthesis of heterocyclic compounds. By utilizing this compound as a starting material, chemists can efficiently synthesize complex molecular structures with diverse properties and functionalities. Its ability to undergo reactions such as esterification, amidation, and cyclization allows for the creation of novel compounds with potential biological activities.Additionally, 5-(Methoxycarbonyl)-1H-pyrrole-2-carboxylic acid can be employed in the preparation of peptide derivatives. Through selective modification of the carboxylic acid and amino groups present in the molecule, researchers can synthesize peptide analogs with enhanced stability and bioavailability. This application is particularly useful in the development of peptide-based therapeutics and biochemical research.Overall, the utility of 5-(Methoxycarbonyl)-1H-pyrrole-2-carboxylic acid in chemical synthesis lies in its versatility and reactivity, making it a valuable tool for creating novel molecules with potential applications in various fields of chemistry and biochemistry.