logo
Home  > 3-Amino-4-methoxybenzanilide

AA33535

120-35-4 | 3-Amino-4-methoxybenzanilide

Packsize Purity Availability Price Discounted Price    Quantity
5g 98% in stock $7.00 $5.00 -   +
25g 98% in stock $20.00 $14.00 -   +
100g 98% in stock $58.00 $41.00 -   +
250g >98.0%(T) in stock $81.00 $57.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA33535
Chemical Name: 3-Amino-4-methoxybenzanilide
CAS Number: 120-35-4
Molecular Formula: C14H14N2O2
Molecular Weight: 242.2732
MDL Number: MFCD00017166
SMILES: COc1ccc(cc1N)C(=O)Nc1ccccc1
NSC Number: 50647

 

Computed Properties
Complexity: 277  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 18  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 3  
XLogP3: 2  

 

 

Upstream Synthesis Route 
  • 3-Amino-4-methoxybenzanilide is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. This compound plays a crucial role in organic chemistry as a building block for the synthesis of various complex molecules and pharmaceuticals.One of the key applications of 3-Amino-4-methoxybenzanilide in chemical synthesis is its use as a starting material for the preparation of analogs and derivatives with enhanced biological activities. The amino and methoxy groups present in the molecule can undergo different reactions, such as acylation, alkylation, and condensation, allowing for the introduction of various functional groups to modify the properties of the final compound.Furthermore, 3-Amino-4-methoxybenzanilide can serve as a precursor for the synthesis of heterocyclic compounds through cyclization reactions. The amino group can participate in ring-forming reactions, leading to the formation of diverse structures with potential pharmacological significance.In addition, this compound can be employed as a reagent in the synthesis of dyes, pigments, and other organic compounds due to its ability to undergo selective transformations under suitable reaction conditions. Its structural features make it a valuable intermediate in the design and development of novel chemical entities with desired properties for various industrial applications.
Literature
FEATURED PRODUCTS