logo
Home  > 8-Bromo-4-chloro-2-methylquinoline

AA33902

1201-07-6 | 8-Bromo-4-chloro-2-methylquinoline

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $20.00 $14.00 -   +
1g 98% in stock $50.00 $35.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA33902
Chemical Name: 8-Bromo-4-chloro-2-methylquinoline
CAS Number: 1201-07-6
Molecular Formula: C10H7BrClN
Molecular Weight: 256.5263
MDL Number: MFCD00272432
SMILES: Cc1cc(Cl)c2c(n1)c(Br)ccc2

 

Upstream Synthesis Route
  • 8-Bromo-4-chloro-2-methylquinoline is a versatile chemical compound used widely in organic synthesis. In the field of chemistry, this compound plays a crucial role as a building block in the construction of various complex organic molecules. Its unique structure and reactivity make it a valuable ingredient in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.In chemical synthesis, 8-Bromo-4-chloro-2-methylquinoline serves as a key intermediate in the production of a variety of bioactive compounds. Its halogen substituents confer distinct properties that enable the selective modification of the quinoline core, allowing chemists to tailor the structure for specific applications. This compound can undergo various functional group transformations, such as nucleophilic substitutions, palladium-catalyzed cross-coupling reactions, and oxidative transformations, to yield a wide range of derivatives with diverse functionalities.Moreover, the presence of bromine and chlorine atoms in strategic positions on the quinoline ring enables the formation of new carbon-carbon and carbon-heteroatom bonds, facilitating the synthesis of complex molecules that are challenging to access by other means. By leveraging the unique reactivity of 8-Bromo-4-chloro-2-methylquinoline, chemists can efficiently assemble molecules with potential biological activities or materials with specific properties.Overall, the application of 8-Bromo-4-chloro-2-methylquinoline in chemical synthesis enables the efficient construction of diverse chemical structures with tailored functionalities, providing a versatile tool for scientists in the design and development of novel molecules for various applications.
FEATURED PRODUCTS