logo
Home  > Magnesium, bromo[4-​(phenylmethoxy)​phenyl]​-

AA34179

120186-59-6 | Magnesium, bromo[4-​(phenylmethoxy)​phenyl]​-

Packsize Purity Availability Price Discounted Price    Quantity
50ml 1 week $357.00 $250.00 -   +
100ml 1 week $609.00 $427.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA34179
Chemical Name: Magnesium, bromo[4-​(phenylmethoxy)​phenyl]​-
CAS Number: 120186-59-6
Molecular Formula: C13H11BrMgO
Molecular Weight: 287.43484
MDL Number: MFCD09039130
SMILES: Br[Mg]c1ccc(cc1)OCc1ccccc1

 

Upstream Synthesis Route
  • Magnesium, bromo[4-(phenylmethoxy)phenyl]- is a versatile compound widely used in chemical synthesis as a powerful Grignard reagent. Grignard reagents are organometallic compounds formed by the reaction of alkyl or aryl halides with magnesium metal. This particular compound is unique due to its phenylmethoxyphenyl group, which imparts specific reactivity and selectivity in various synthetic reactions.In chemical synthesis, Magnesium, bromo[4-(phenylmethoxy)phenyl]- serves as a crucial intermediate for the construction of complex organic molecules. It participates in reactions such as nucleophilic addition, substitution, and coupling reactions, enabling the formation of new carbon-carbon bonds. Its reactivity makes it a valuable tool for the creation of pharmaceuticals, agrochemicals, and advanced materials.Additionally, this compound is employed in the synthesis of biologically active compounds, natural products, and fine chemicals. Its ability to efficiently transfer the phenylmethoxyphenyl group to different substrates allows chemists to modify and functionalize organic molecules in a controlled manner. This versatility opens up a wide range of possibilities for customizing chemical structures and developing novel compounds with specific properties.Overall, Magnesium, bromo[4-(phenylmethoxy)phenyl]- plays a crucial role in modern synthetic chemistry, facilitating the creation of diverse and sophisticated organic compounds for various industrial and research applications.
FEATURED PRODUCTS