AE25372
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $137.00 | $96.00 | - + | |
5mg | 99% | in stock | $601.00 | $421.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE25372 |
Chemical Name: | Glycochenodeoxycholic Acid-d4 |
CAS Number: | 1201918-16-2 |
Molecular Formula: | C26H39D4NO5 |
Molecular Weight: | 453.648 |
MDL Number: | MFCD03425572 |
SMILES: | O=C(CC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2[C@H](O)C[C@H]2[C@]1(C)CC([2H])([2H])[C@H](C2([2H])[2H])O)C)NCC(=O)O |
N-[(3α,5β,7α)-3,7-Dihydroxy-24-oxocholan-24-yl-2,2,4,4-d4]glycine, a stable isotope-labeled bile acid derivative, finds significant application in chemical synthesis, particularly in the field of pharmaceutical research and development. This compound serves as a valuable tool for tracing and studying metabolic pathways, drug metabolism, and pharmacokinetics. Its labeled structure allows for precise tracking and identification in complex biological systems, aiding in the elucidation of important biochemical processes. Additionally, N-[(3α,5β,7α)-3,7-Dihydroxy-24-oxocholan-24-yl-2,2,4,4-d4]glycine plays a crucial role in the synthesis of labeled compounds for use in various analytical techniques such as mass spectrometry and nuclear magnetic resonance spectroscopy. Its unique properties make it an indispensable component in the development of novel drugs and understanding the intricate mechanisms of biological systems.