BJ78271
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BJ78271 |
Chemical Name: | Sodium 10b-Ffluoro-1,3,4,4a,4b,5,6,10a,10b,11,12,12a-dodecahydro-1,11-dihydroxy-3,10a,12a-trimethyl-1-[(phosphonooxy)methyl]-2,8-chrysenedione |
CAS Number: | 1201919-18-7 |
Molecular Formula: | C22H28FNa2O8P |
Molecular Weight: | 516.4046 |
SMILES: | [Na]OP(=O)(OC[C@]1(O)C(=O)[C@@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F)O[Na] |
Sodium 10b-fluoro-1,3,4,4a,4b,5,6,10a,10b,11,12,12a-dodecahydro-1,11-dihydroxy-3,10a,12a-trimethyl-1-[(phosphonooxy)methyl]-2,8-chrysenedione is a versatile compound widely used in chemical synthesis processes. Its unique structure and properties make it a valuable reagent in the synthesis of complex organic molecules and pharmaceutical intermediates. This compound serves as a key building block for the construction of intricate molecular structures due to its ability to undergo various chemical transformations, such as alkylation, oxidation, and condensation reactions. Through strategic manipulation of its functional groups, this compound enables chemists to access diverse chemical scaffolds and achieve challenging molecular architectures efficiently. In addition, its fluorinated moiety can impart valuable properties to the final products, such as improved metabolic stability and enhanced biological activity in drug discovery applications.