AA34224
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $9.00 | $7.00 | - + | |
25g | 98% | in stock | $12.00 | $9.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA34224 |
Chemical Name: | Methyl indole-2-carboxylate |
CAS Number: | 1202-04-6 |
Molecular Formula: | C10H9NO2 |
Molecular Weight: | 175.184 |
MDL Number: | MFCD00460779 |
SMILES: | COC(=O)c1cc2c([nH]1)cccc2 |
NSC Number: | 78006 |
Complexity: | 205 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.5 |
Bioorganic & medicinal chemistry letters 20101101
The Journal of organic chemistry 20050429
Organic letters 20040819