AY12554
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | in stock | $81.00 | $57.00 | - + | ||
5g | in stock | $252.00 | $177.00 | - + | ||
25g | in stock | $746.00 | $522.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY12554 |
Chemical Name: | 2,2',2'',2'''-((((1,1-Doxido-3H-benzo[c][1,2]oxathiole-3,3-diyl)bis(6-hydroxy-5-methyl-3,1-phenylene))bis(methylene))bis(azanetriyl))tetraacetic acid disodium salt |
CAS Number: | 1202864-39-8 |
Molecular Formula: | C31H30N2Na2O13S |
Molecular Weight: | 716.62 |
MDL Number: | MFCD00014580 |
SMILES: | [O-]C(=O)CN(Cc1cc(cc(c1O)C)C1(OS(=O)(=O)c2c1cccc2)c1cc(C)c(c(c1)CN(CC(=O)O)CC(=O)O)O)CC(=O)[O-].[Na+].[Na+] |
In chemical synthesis, 2,2',2'',2'''-((((1,1-Doxido-3H-benzo[c][1,2]oxathiole-3,3-diyl)bis(6-hydroxy-5-methyl-3,1-phenylene))bis(methylene))bis(azanetriyl))tetraacetic acid disodium salt serves as a versatile chelating agent due to its unique structural properties. This compound can effectively coordinate with metal ions, facilitating the formation of stable complexes that are crucial in various synthetic pathways. Its ability to form strong coordination bonds makes it an ideal candidate for controlling and manipulating reaction processes, particularly in complexation reactions, metal-catalyzed transformations, and coordination chemistry studies. The presence of multiple chelating sites in the molecule enhances its coordination capabilities, enabling precise control over metal ion binding and reactivity, thereby making it a valuable tool in chemical synthesis applications.