AE11125
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $10.00 | $7.00 | - + | |
5mg | 98% | in stock | $21.00 | $15.00 | - + | |
10mg | 98% | in stock | $32.00 | $22.00 | - + | |
100mg | 95% | in stock | $222.00 | $156.00 | - + | |
250mg | 95% | in stock | $361.00 | $253.00 | - + | |
1g | 95% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11125 |
Chemical Name: | (5Z)-5-({2-[(3R)-3-Aminopiperidin-1-yl]-3-phenylphenyl}methylidene)-1,3-thiazolidine-2,4-dione |
CAS Number: | 1204144-28-4 |
Molecular Formula: | C21H21N3O2S |
Molecular Weight: | 379.4753 |
MDL Number: | MFCD25976757 |
SMILES: | N[C@@H]1CCCN(C1)c1c(cccc1c1ccccc1)/C=C/1\SC(=O)NC1=O |
Complexity: | 602 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.6 |
Journal of medicinal chemistry 20151112
ACS medicinal chemistry letters 20131212