AD60008
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $63.00 | $45.00 | - + | |
250mg | 97% | in stock | $91.00 | $64.00 | - + | |
1g | 97% | in stock | $209.00 | $147.00 | - + | |
5g | 97% | in stock | $617.00 | $432.00 | - + | |
10g | 97% | in stock | $1,058.00 | $741.00 | - + | |
25g | 97% | in stock | $2,205.00 | $1,544.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD60008 |
Chemical Name: | (R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid hydrochloride |
CAS Number: | 1204818-19-8 |
Molecular Formula: | C10H11ClF3NO2 |
Molecular Weight: | 269.648 |
MDL Number: | MFCD06659146 |
SMILES: | N[C@@H](CC(=O)O)Cc1cc(F)c(cc1F)F.Cl |
Complexity: | 252 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
The (R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid hydrochloride is a versatile compound widely utilized in chemical synthesis processes. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, it acts as a chiral amino acid derivative, providing a crucial element for the development of enantiomerically pure compounds. Its unique structure and properties make it a valuable tool for the synthesis of complex molecules with specific stereochemical requirements.