logo
Home  > Rel-benzyl (3r,4r)-3-amino-4-fluoropiperidine-1-carboxylate

AI13369

1207853-15-3 | Rel-benzyl (3r,4r)-3-amino-4-fluoropiperidine-1-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $163.00 $114.00 -   +
250mg 95% in stock $217.00 $152.00 -   +
500mg 95% in stock $433.00 $303.00 -   +
1g 95% in stock $666.00 $466.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI13369
Chemical Name: Rel-benzyl (3r,4r)-3-amino-4-fluoropiperidine-1-carboxylate
CAS Number: 1207853-15-3
Molecular Formula: C13H17FN2O2
Molecular Weight: 252.2847
MDL Number: MFCD24857127
SMILES: F[C@@H]1CCN(C[C@H]1N)C(=O)OCc1ccccc1

 

Upstream Synthesis Route 
  • The (3R,4R)-rel-Benzyl 3-amino-4-fluoropiperidine-1-carboxylate is a valuable compound used in chemical synthesis for its stereochemistry and functional groups. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique structural properties. Its precise configuration and specific molecular arrangement make it an essential component in the development of new chemical entities with desired biological activities. Additionally, the presence of the benzyl group enhances the compound's reactivity and compatibility in numerous synthetic pathways, allowing for efficient transformations and derivatizations in complex organic synthesis strategies. The (3R,4R)-rel-Benzyl 3-amino-4-fluoropiperidine-1-carboxylate plays a crucial role in facilitating the synthesis of diverse molecular structures with potential applications across different industries.
FEATURED PRODUCTS