BH63946
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BH63946 |
Chemical Name: | (2R,3R)-1-[(tert-butoxy)carbonyl]-3-hydroxypiperidine-2-carboxylic acid |
CAS Number: | 1207962-80-8 |
Molecular Formula: | C11H19NO5 |
Molecular Weight: | 245.2723 |
MDL Number: | MFCD15071867 |
SMILES: | O[C@@H]1CCCN([C@H]1C(=O)O)C(=O)OC(C)(C)C |
The compound (2R,3R)-1-[(tert-Butoxy)carbonyl]-3-hydroxypiperidine-2-carboxylic acid is commonly utilized in chemical synthesis as a valuable building block for the creation of various pharmaceuticals, chiral ligands, and bioactive molecules. This compound is particularly important in organic synthesis due to its chiral nature, which imparts unique stereochemical characteristics to the final products. By incorporating this acid into chemical reactions, chemists can selectively manipulate the stereochemistry of the resulting compounds, leading to the production of diverse and structurally complex molecules. Its versatility and reliability make it an indispensable tool in the efficient synthesis of potential drug candidates and other biologically active compounds.