AB50352
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $27.00 | $19.00 | - + | |
5g | 98% | in stock | $106.00 | $75.00 | - + | |
10g | 98% | in stock | $158.00 | $111.00 | - + | |
25g | 98% | in stock | $325.00 | $228.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50352 |
Chemical Name: | 4-Chloro-3-nitrobenzenesulfonic acid |
CAS Number: | 121-18-6 |
Molecular Formula: | C6H4ClNO5S |
Molecular Weight: | 237.6177 |
MDL Number: | MFCD00274152 |
SMILES: | [O-][N+](=O)c1cc(ccc1Cl)S(=O)(=O)O |
NSC Number: | 7827 |
Complexity: | 318 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1 |
The compound Benzenesulfonic acid, 4-chloro-3-nitro-, is a key reagent used in various chemical synthesis processes. This compound serves as a versatile building block in organic chemistry, particularly in the pharmaceutical and agrochemical industries. Its unique chemical structure makes it valuable in the synthesis of advanced materials, including dyes, pigments, and specialty chemicals. Benzenesulfonic acid, 4-chloro-3-nitro-, plays a crucial role as a precursor in the preparation of pharmaceutical intermediates and active ingredients.Furthermore, this compound is utilized in the manufacturing of various organic compounds due to its reactivity and ability to introduce specific functional groups. Its presence in synthesis enables chemists to modify molecular structures with precision, leading to the creation of novel molecules with tailored properties.In summary, Benzenesulfonic acid, 4-chloro-3-nitro-, is a fundamental reagent that significantly contributes to the advancement of chemical synthesis by enabling the construction of complex organic molecules with diverse applications.