logo
Home  > 4-Acetamidobenzenesulfonamide

AB66488

121-61-9 | 4-Acetamidobenzenesulfonamide

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $14.00 $10.00 -   +
5g 98% in stock $23.00 $16.00 -   +
25g 98% in stock $39.00 $27.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB66488
Chemical Name: 4-Acetamidobenzenesulfonamide
CAS Number: 121-61-9
Molecular Formula: C8H10N2O3S
Molecular Weight: 214.2416
MDL Number: MFCD00035784
SMILES: CC(=O)Nc1ccc(cc1)S(=O)(=O)N

 

Computed Properties
Complexity: 299  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 14  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 2  

 

 

Upstream Synthesis Route 
  • Acetamide, N-[4-(aminosulfonyl)phenyl]- is a versatile chemical compound that plays a crucial role in chemical synthesis processes. In the realm of organic chemistry, this particular compound serves as a valuable building block for the creation of intricate molecular structures. Its unique properties enable it to act as a key intermediate in the production of various pharmaceuticals, agrochemicals, and materials.This compound's chemical synthesis application lies in its ability to participate in various reactions that lead to the formation of more complex molecules. Through judicious manipulation of its chemical structure, Acetamide, N-[4-(aminosulfonyl)phenyl]- can be transformed into a wide array of derivatives with diverse functionalities. This flexibility makes it an indispensable tool for chemists working on the design and development of new compounds with specialized properties and applications.Furthermore, the incorporation of Acetamide, N-[4-(aminosulfonyl)phenyl]- into synthetic pathways allows for the efficient construction of molecules that may not be easily accessible through other means. Its presence in a chemical synthesis scheme can enhance the overall yield of desired products while enabling the controlled modification of molecular frameworks to achieve desired outcomes. As such, this compound serves as a valuable resource for synthetic chemists seeking to explore new frontiers in molecular design and application.
Literature
FEATURED PRODUCTS