logo
Home  > SN-38 Glucuronide

AD31913

121080-63-5 | SN-38 Glucuronide

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $692.00 $485.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD31913
Chemical Name: SN-38 Glucuronide
CAS Number: 121080-63-5
Molecular Formula: C28H28N2O11
Molecular Weight: 568.5287199999998
MDL Number: MFCD00872153
SMILES: CC[C@@]1(O)C(=O)OCc2c1cc1-c3nc4ccc(cc4c(c3Cn1c2=O)CC)O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O

 

Upstream Synthesis Route 
  • SN-38 Glucuronide, a derivative of SN-38, serves as a crucial component in chemical synthesis. Known for its ability to improve solubility and stability, SN-38 Glucuronide plays a significant role in various pharmaceutical and research applications. In the realm of drug development, it is utilized to enhance the bioavailability and efficacy of medication formulations. Additionally, in organic chemistry, this compound serves as a valuable intermediate, allowing for the synthesis of complex molecules with enhanced properties. Overall, SN-38 Glucuronide serves as a versatile tool in chemical synthesis, enabling researchers to achieve precise structural modifications and develop novel compounds with improved characteristics.
FEATURED PRODUCTS