logo
Home  > Secodihydro-HydramMelin B

AE41559

1212148-58-7 | Secodihydro-HydramMelin B

Packsize Purity Availability Price Discounted Price    Quantity
5mg 95% 2 weeks $1,205.00 $844.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE41559
Chemical Name: Secodihydro-HydramMelin B
CAS Number: 1212148-58-7
Molecular Formula: C15H18O8
Molecular Weight: 326.2986
MDL Number: MFCD23103614
SMILES: COc1cc(O)c(cc1C1OC(=O)C(C1O)(C)O)CCC(=O)O

 

Upstream Synthesis Route 
  • The compound Secodihydro-HydramMelin B serves as a valuable tool in the field of chemical synthesis, particularly in the realm of organic chemistry. Known for its unique structural properties and reactivity, this compound is widely utilized as a versatile reagent in various synthetic transformations. Its ability to participate in key bond-forming reactions, such as carbon-carbon and carbon-heteroatom bond formations, makes it an essential component in the creation of complex organic molecules. Additionally, Secodihydro-HydramMelin B can facilitate selective functional group manipulations and enable the construction of intricate molecular frameworks with high precision. Its versatile nature and broad synthetic applicability make it a valuable resource for chemists seeking to access new chemical entities and explore innovative synthetic pathways.
FEATURED PRODUCTS