121225-98-7 | 7-Oxabicyclo[4.1.0]heptane,3,3',3'',3'''-[(2,4,6,8-tetramethylcyclotetrasiloxane-2,4,6,8-tetrayl)tetra-2,1-ethanediyl]tetrakis-

Packsize	Purity	Availability	Price	Discounted Price
1g	95%	2 weeks	$165.00	$115.00
5g	95%	2 weeks	$507.00	$355.00
25g	95%	2 weeks	$894.00	$626.00
100g	95%	2 weeks	$1,800.00	$1,260.00

Description

• Catalog Number: AX56444
• Chemical Name: 7-Oxabicyclo[4.1.0]heptane,3,3',3'',3'''-[(2,4,6,8-tetramethylcyclotetrasiloxane-2,4,6,8-tetrayl)tetra-2,1-ethanediyl]tetrakis-
• CAS Number: 121225-98-7
• Molecular Formula: C36H64O8Si4
• Molecular Weight: 737.2306
• SMILES: C[Si]1(O[Si](O[Si](O[Si](O1)(C)CCC2CCC3C(C2)O3)(C)CCC4CCC5C(C4)O5)(C)CCC6CCC7C(C6)O7)CCC8CCC9C(C8)O9

Upstream Synthesis Route

2,4,6,8-Tetra[2-(3,4-epoxycyclohexylethyl)]tetramethylcyclotetrasiloxane, also known as $name$, is a versatile compound widely used in chemical synthesis. Its unique chemical structure makes it a valuable tool in organic chemistry for various applications.In chemical synthesis, $name$ serves as a key building block for the preparation of advanced materials and specialty chemicals. Due to its reactive epoxy groups and silicon backbone, $name$ can undergo various chemical reactions, such as cross-linking, polymerization, and functionalization reactions. This enables the incorporation of $name$ into complex molecular structures, enhancing the properties of the final products.One of the primary applications of 2,4,6,8-Tetra[2-(3,4-epoxycyclohexylethyl)]tetramethylcyclotetrasiloxane in chemical synthesis is in the synthesis of functional polymers and resins. By incorporating $name$ into polymer chains, researchers can tailor the properties of the resulting materials, such as adhesion, flexibility, and thermal stability. Additionally, $name$ can be utilized as a cross-linking agent to improve the mechanical strength and chemical resistance of polymers.Furthermore, $name$ is employed in the preparation of specialty coatings, adhesives, and sealants due to its unique structural features. Its cyclic siloxane structure imparts high thermal stability and resistance to environmental factors, making it ideal for applications requiring durability and long-term performance.Overall, 2,4,6,8-Tetra[2-(3,4-epoxycyclohexylethyl)]tetramethylcyclotetrasiloxane plays a crucial role in chemical synthesis by enabling the development of advanced materials with tailored properties and enhanced performance characteristics.