logo
Home  > (1R)-2-Chloro-1-(3,4-Difluorophenyl)-1-Ethanol

AE79265

1212376-05-0 | (1R)-2-Chloro-1-(3,4-Difluorophenyl)-1-Ethanol

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $29.00 $21.00 -   +
250mg 98% in stock $32.00 $23.00 -   +
1g 98% in stock $55.00 $39.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE79265
Chemical Name: (1R)-2-Chloro-1-(3,4-Difluorophenyl)-1-Ethanol
CAS Number: 1212376-05-0
Molecular Formula: C8H7ClF2O
Molecular Weight: 192.5903864
MDL Number: MFCD09863591
SMILES: ClC[C@@H](c1ccc(c(c1)F)F)O

 

Upstream Synthesis Route 
  • (1R)-2-Chloro-1-(3,4-difluorophenyl)-1-ethanol, also known as Ticagrelor Impurity, plays a crucial role in chemical synthesis as a key intermediate in the production of pharmaceutical compounds. This compound serves as a building block in the synthesis of advanced drug molecules by facilitating various reactions such as nucleophilic substitution, oxidation, and rearrangement. Its unique structure and reactivity allow for the formation of complex molecular architectures, making it a valuable tool in the field of medicinal chemistry.
FEATURED PRODUCTS