AD74703
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $6.00 | $4.00 | - + | |
5mg | 98% | in stock | $7.00 | $5.00 | - + | |
10mg | 98% | in stock | $9.00 | $6.00 | - + | |
50mg | 98% | in stock | $14.00 | $10.00 | - + | |
250mg | 98% | in stock | $52.00 | $36.00 | - + | |
1g | 98% | in stock | $111.00 | $78.00 | - + | |
5g | 98% | in stock | $339.00 | $237.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD74703 |
Chemical Name: | N-(3-(5-Chloro-2-(2-methoxy-4-(4-methylpiperazin-1-yl)phenylamino)pyrimidin-4-yloxy)phenyl)acrylamide |
CAS Number: | 1213269-23-8 |
Molecular Formula: | C25H27ClN6O3 |
Molecular Weight: | 494.9733 |
MDL Number: | MFCD16621244 |
SMILES: | C=CC(=O)Nc1cccc(c1)Oc1nc(ncc1Cl)Nc1ccc(cc1OC)N1CCN(CC1)C |
Complexity: | 694 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.2 |
Bioorganic & medicinal chemistry letters 20130801
Molecular cancer therapeutics 20121001
Journal of medicinal chemistry 20120726
Biochemical and biophysical research communications 20120713
Clinical cancer research : an official journal of the American Association for Cancer Research 20120701
Journal of medicinal chemistry 20120322
Laboratory investigation; a journal of technical methods and pathology 20120301
Nature 20091224