AB53869
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 2 weeks | $105.00 | $73.00 | - + | ||
2mg | 2 weeks | $123.00 | $86.00 | - + | ||
3mg | 2 weeks | $149.00 | $105.00 | - + | ||
5mg | 2 weeks | $168.00 | $118.00 | - + | ||
10mg | 2 weeks | $193.00 | $135.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53869 |
Chemical Name: | 3-(3-Fluoro-4-nitrophenyl)pyridine |
CAS Number: | 1214342-03-6 |
Molecular Formula: | C11H7FN2O2 |
Molecular Weight: | 218.1839 |
MDL Number: | MFCD15475669 |
SMILES: | [O-][N+](=O)c1ccc(cc1F)c1cccnc1 |
Complexity: | 257 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.4 |
The 3-(3-Fluoro-4-nitrophenyl)pyridine is a versatile compound widely used in chemical synthesis. In organic chemistry, it serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. Due to its unique structure, this compound plays a crucial role in the development of new molecular entities with diverse biological activities.One of the primary applications of 3-(3-Fluoro-4-nitrophenyl)pyridine is in the synthesis of heterocyclic compounds. By utilizing its functional groups and reactivity, chemists can introduce additional substituents or modify its structure to create complex heterocycles with specific properties. This compound is particularly valuable in the preparation of biologically active molecules such as drug candidates and molecular probes.Furthermore, 3-(3-Fluoro-4-nitrophenyl)pyridine is used as a key intermediate in the synthesis of various functional materials. Its ability to participate in diverse chemical reactions makes it a valuable tool for the construction of complex molecular architectures with tailored properties. In materials science, this compound can be employed to develop advanced organic electronic materials, dyes, and catalysts with enhanced performance characteristics.Overall, the 3-(3-Fluoro-4-nitrophenyl)pyridine is a valuable synthetic building block that enables chemists to access a wide range of structurally diverse compounds with applications in pharmaceuticals, materials science, and other fields of chemical research. Its versatility and reactivity make it an essential component in the toolbox of synthetic chemists seeking to create novel molecules with tailored properties and functionalities.