AA53820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | 1 week | $126.00 | $88.00 | - + | |
10mg | 99% | 1 week | $170.00 | $119.00 | - + | |
25mg | 99% | 1 week | $290.00 | $203.00 | - + | |
50mg | 99% | 1 week | $440.00 | $308.00 | - + | |
100mg | 99% | 1 week | $650.00 | $455.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA53820 |
Chemical Name: | Butanoic acid, 2-azido-3-methyl-, compd. with cyclohexanamine (1:1), (2S)- |
CAS Number: | 1217462-63-9 |
Molecular Formula: | C11H22N4O2 |
Molecular Weight: | 242.318 |
MDL Number: | MFCD11223823 |
SMILES: | CC([C@@H](C(=O)O)N=[N+]=[N-])C.NC1CCCCC1 |