AA54562
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $291.00 | $204.00 | - + | |
1g | 96% | in stock | $558.00 | $391.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54562 |
Chemical Name: | 5-(Pyrrolidinocarbonyl)pyridine-3-boronic acid, pinacol ester |
CAS Number: | 1218790-21-6 |
Molecular Formula: | C16H23BN2O3 |
Molecular Weight: | 302.17641999999995 |
MDL Number: | MFCD15143600 |
SMILES: | O=C(c1cncc(c1)B1OC(C(O1)(C)C)(C)C)N1CCCC1 |
Complexity: | 419 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
Pyrrolidin-1-yl(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl);pyridin-3-yl);methanone is a versatile compound widely employed in chemical synthesis due to its unique reactivity and functional group compatibility. This compound is commonly used as a key building block in the construction of complex organic molecules and pharmaceuticals. Its ability to participate in various coupling reactions, such as Suzuki-Miyaura cross-coupling and Heck coupling, enables the efficient formation of carbon-carbon and carbon-heteroatom bonds. Furthermore, the distinctive structural features of this compound make it an essential tool in the development of novel drug candidates and bioactive compounds. Its diverse applications in chemical synthesis highlight the significant role of Pyrrolidin-1-yl(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl);pyridin-3-yl);methanone in advancing the field of organic chemistry.