AA54642
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $46.00 | $32.00 | - + | |
1g | 95% | in stock | $105.00 | $74.00 | - + | |
5g | 95% | in stock | $339.00 | $237.00 | - + | |
10g | 95% | in stock | $572.00 | $400.00 | - + | |
25g | 95% | in stock | $1,131.00 | $792.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA54642 |
Chemical Name: | 2-Ethylaminopyrimidine-5-boronic acid, pinacol ester |
CAS Number: | 1218791-44-6 |
Molecular Formula: | C12H20BN3O2 |
Molecular Weight: | 249.1171 |
MDL Number: | MFCD12546554 |
SMILES: | CCNc1ncc(cn1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 275 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
The N-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine is a versatile compound commonly used in chemical synthesis processes. Its unique molecular structure makes it a valuable reagent for various organic reactions, particularly in the formation of carbon-carbon and carbon-nitrogen bonds. This compound serves as a crucial building block in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its ability to participate in key coupling reactions. The N-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine offers chemists a reliable and efficient tool for the creation of complex molecular structures with high precision and control.