logo
Home  > Fmoc-2-amino-4,4,4-trifluorobutyric acid

AE34007

1219145-37-5 | Fmoc-2-amino-4,4,4-trifluorobutyric acid

Packsize Purity Availability Price Discounted Price    Quantity
25mg 98% in stock $149.00 $105.00 -   +
100mg 98% in stock $277.00 $194.00 -   +
250mg 98% in stock $493.00 $345.00 -   +
1g 98% in stock $1,009.00 $707.00 -   +
5g 98% in stock $4,023.00 $2,816.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE34007
Chemical Name: Fmoc-2-amino-4,4,4-trifluorobutyric acid
CAS Number: 1219145-37-5
Molecular Formula: C19H16F3NO4
Molecular Weight: 379.3298
MDL Number: MFCD02682447
SMILES: O=C(NC(C(=O)O)CC(F)(F)F)OCC1c2ccccc2-c2c1cccc2

 

Upstream Synthesis Route
  • The compound $name$ is a valuable tool in chemical synthesis due to its unique properties and versatile applications. It serves as a crucial building block in the creation of complex molecules, particularly in the field of medicinal and pharmaceutical chemistry. With its specific structure, 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic Acid allows for precise manipulation and transformation during synthetic processes, enabling the synthesis of diverse compounds with enhanced properties.Its presence in chemical synthesis facilitates the modification of existing molecules or the creation of novel structures with tailored functionalities. By serving as a key intermediate in multi-step synthesis, this compound plays a crucial role in the development of new drugs, agrochemicals, materials, and other important products. Its incorporation allows chemists to introduce specific functionalities, enhance stability, or improve bioavailability, leading to the creation of innovative solutions to various challenges in different industries.Furthermore, the reactivity of 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic Acid enables chemists to perform a wide range of chemical transformations, such as coupling reactions, functional group manipulations, and stereochemical control. This versatility makes it a valuable tool for synthetic chemists seeking efficient and precise methods to access complex molecules with high yields and purity.In summary, 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic Acid is an essential component in the arsenal of synthetic chemists, providing them with the means to innovate and create a myriad of chemical compounds with diverse applications and properties.
FEATURED PRODUCTS