12192-57-3 | Aurothioglucose

Packsize	Purity	Availability	Price	Discounted Price
1mg	96%	1 week	$405.00	$283.00
100mg	96%	1 week	$558.00	$390.00

Description

• Catalog Number: AV19816
• Chemical Name: Aurothioglucose
• CAS Number: 12192-57-3
• Molecular Formula: C6H11AuO5S
• Molecular Weight: 392.1801
• MDL Number: MFCD00056080
• SMILES: OC[C@H]1OC2[SH-][Au+]O[C@@H]2[C@H]([C@@H]1O)O

Upstream Synthesis Route

Aurothioglucose, also known as gold thioglucose or gold sodium thiomalate, is a unique compound that finds application in chemical synthesis, particularly in the field of medicinal chemistry. Due to its gold component, aurothioglucose possesses notable properties that make it valuable in various synthetic processes.One key application of aurothioglucose in chemical synthesis is its use as a precursor in the preparation of gold nanoparticles. These nanoparticles have gained significant attention in recent years due to their exceptional catalytic, optical, and electronic properties. Aurothioglucose serves as a starting material for the synthesis of gold nanoparticles through various methods such as reduction reactions, providing a versatile platform for the production of nanomaterials with tailored properties.Furthermore, aurothioglucose is utilized in the development of novel gold-based pharmaceuticals. Its unique chemical structure allows for the conjugation of bioactive molecules or drugs, leading to the formation of gold complexes with potential therapeutic applications. These complexes have shown promise in the treatment of conditions such as rheumatoid arthritis and certain types of cancer, highlighting the significance of aurothioglucose in medicinal chemistry research.In addition to its role in nanoparticle synthesis and pharmaceutical development, aurothioglucose is also utilized as a stabilizing agent in various chemical reactions. Its ability to form stable complexes with metal ions makes it an ideal candidate for promoting specific chemical transformations, especially in the context of organic synthesis.Overall, aurothioglucose plays a crucial role in chemical synthesis by enabling the creation of advanced materials, pharmaceutical compounds, and catalytic systems. Its versatile nature and unique properties make it a valuable tool for researchers and chemists seeking to innovate in diverse areas of science and technology.