AV80731
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 3 weeks | $747.00 | $523.00 | - + | |
5mg | 95% | 3 weeks | $843.00 | $590.00 | - + | |
10mg | 95% | 3 weeks | $912.00 | $639.00 | - + | |
25mg | 95% | 3 weeks | $1,160.00 | $812.00 | - + | |
50mg | 95% | 3 weeks | $1,677.00 | $1,174.00 | - + | |
100mg | 95% | 3 weeks | $2,365.00 | $1,656.00 | - + | |
1g | 95% | 3 weeks | $2,815.00 | $1,971.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV80731 |
Chemical Name: | 2-[(CYCLOPROPYLCARBONYL)AMINO]-4,5,6,7-TETRAHYDRO-1,3-BENZOTHIAZOLE-4-CAR+ |
CAS Number: | 1219827-94-7 |
Molecular Formula: | C12H14N2O3S |
Molecular Weight: | 266.3162 |
MDL Number: | MFCD16653323 |
SMILES: | OC(=O)C1CCCc2c1nc(s2)NC(=O)C1CC1 |
The compound 2-[(cyclopropylcarbonyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid plays a crucial role in chemical synthesis as a versatile building block. Its cyclopropylcarbonyl amino group offers a unique reactivity profile, making it a valuable intermediate in the preparation of various pharmaceuticals and agrochemicals. This compound can be utilized as a key component in the synthesis of complex molecules due to its structural features, enabling the creation of diverse chemical structures through strategic modifications. Its presence in a synthetic pathway can facilitate the introduction of specific functionalities or stereochemical elements, contributing to the development of novel compounds with potential biological activities.