1220699-06-8 | PF-04979064

Packsize	Purity	Availability	Price	Discounted Price
1mg	98%	in stock	$34.00	$24.00
5mg	98%	in stock	$141.00	$99.00
10mg	98%	in stock	$263.00	$184.00
25mg	98%	in stock	$575.00	$403.00

Description

• Catalog Number: AE36100
• Chemical Name: PF-04979064
• CAS Number: 1220699-06-8
• Molecular Formula: C24H26N6O3
• Molecular Weight: 446.5016
• MDL Number: MFCD28155091
• SMILES: O=C(N1CCC(CC1)n1c(=O)n(c2c1c1nc(ccc1nc2)c1ccc(nc1)C)C)[C@@H](O)C

Upstream Synthesis Route

As a chemist, 1,3-Dihydro-1-[1-[(2S)-2-hydroxy-1-oxopropyl]-4-piperidinyl]-3-methyl-8-(6-methyl-3-pyridinyl)-2H-imidazo[4,5-c][1,5]naphthyridin-2-one serves as a valuable intermediate in chemical synthesis processes. This compound plays a crucial role in the development of novel drugs and pharmaceuticals due to its diverse structural features. Its functional groups provide unique opportunities for creating complex molecules with specific biological activities.In chemical synthesis, this compound can be utilized as a building block for constructing pharmacologically active compounds, such as potential anti-cancer agents or antibiotics. Its versatile structure allows for modifications and derivatizations, leading to the generation of chemical libraries for drug discovery purposes.Moreover, the presence of a piperidine moiety in the molecule offers the potential for interactions with biological targets, making it an attractive scaffold for medicinal chemistry studies. By incorporating this compound into synthetic pathways, chemists can explore new pathways for synthesizing biologically relevant molecules with enhanced pharmacological properties.