logo
Home  > 2,2'-(4,6-Dichloro-5-methoxy-1,3-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)

AX07255

1221589-79-2 | 2,2'-(4,6-Dichloro-5-methoxy-1,3-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AX07255
Chemical Name: 2,2'-(4,6-Dichloro-5-methoxy-1,3-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)
CAS Number: 1221589-79-2
Molecular Formula: C19H28B2Cl2O5
Molecular Weight: 428.9506
MDL Number: MFCD29917023
SMILES: COc1c(Cl)c(cc(c1Cl)B1OC(C(O1)(C)C)(C)C)B1OC(C(O1)(C)C)(C)C

 

Upstream Synthesis Route
  • 2-[2,4-dichloro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a versatile compound widely used in chemical synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. It serves as a valuable building block in the construction of complex organic molecules due to its unique reactivity and stability. This compound is particularly valuable in Suzuki-Miyaura cross-coupling reactions, where it acts as a boron source to introduce the desired aryl group onto another organic molecule. Additionally, it finds application in the synthesis of pharmaceuticals, agrochemicals, and materials due to its ability to facilitate selective and efficient bond formation processes. Its controlled reactivity and compatibility with a variety of functional groups make it an essential tool in the toolbox of synthetic chemists striving to create novel compounds with tailored properties.
FEATURED PRODUCTS