logo
Home  > 8-Azabicyclo[3.2.1]octane-3,8-dicarboxylic acid, 8-(1,1-dimethylethyl) ester, (3-endo)-

AA55611

1222996-05-5 | 8-Azabicyclo[3.2.1]octane-3,8-dicarboxylic acid, 8-(1,1-dimethylethyl) ester, (3-endo)-

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $152.00 $106.00 -   +
250mg 95% in stock $267.00 $187.00 -   +
500mg 95% in stock $487.00 $341.00 -   +
1g 95% in stock $833.00 $583.00 -   +
5g 95% in stock $2,611.00 $1,828.00 -   +
10g 95% in stock $4,352.00 $3,046.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA55611
Chemical Name: 8-Azabicyclo[3.2.1]octane-3,8-dicarboxylic acid, 8-(1,1-dimethylethyl) ester, (3-endo)-
CAS Number: 1222996-05-5
Molecular Formula: C13H21NO4
Molecular Weight: 255.3101
MDL Number: MFCD17214354
SMILES: OC(=O)C1C[C@@H]2CC[C@H](C1)N2C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The (3-endo)-8-(tert-Butoxycarbonyl)-8-azabicyclo[3.2.1]octane-3-carboxylic acid is a versatile compound commonly used in chemical synthesis. This compound is valued for its ability to serve as a key building block in the creation of various organic molecules and pharmaceuticals. Its unique structure and reactivity make it a valuable tool in the development of complex chemical compounds. Additionally, its specific stereochemistry allows for the precise control of reactions, leading to the formation of desired products with high efficiency. The application of this compound in chemical synthesis enables researchers to efficiently construct intricate molecular structures, making it a valuable asset in the field of organic chemistry.
FEATURED PRODUCTS