AE35801
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $67.00 | $47.00 | - + | |
100mg | ≥97% | in stock | $1,049.00 | $734.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35801 |
Chemical Name: | Torin 1 |
CAS Number: | 1222998-36-8 |
Molecular Formula: | C35H28F3N5O2 |
Molecular Weight: | 607.6243 |
MDL Number: | MFCD18782653 |
SMILES: | CCC(=O)N1CCN(CC1)c1ccc(cc1C(F)(F)F)n1c(=O)ccc2c1c1cc(ccc1nc2)c1cnc2c(c1)cccc2 |
Complexity: | 1110 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 45 |
Hydrogen Bond Acceptor Count: | 8 |
Rotatable Bond Count: | 4 |
XLogP3: | 6 |
Autophagy 20160101
Molecular cell 20151015
The Journal of biological chemistry 20150626
International journal of molecular sciences 20150101
Bioorganic & medicinal chemistry letters 20130801
Cell research 20120901
Biochemical and biophysical research communications 20120601
Nature 20120503
Molecular cancer research : MCR 20120501
Chinese journal of cancer 20120101
Methods in molecular biology (Clifton, N.J.) 20120101
Blood 20111222
The Journal of biological chemistry 20110715
American journal of physiology. Cell physiology 20110701
Bioorganic & medicinal chemistry letters 20110701
Science (New York, N.Y.) 20110610
Blood 20110421
Biochemical and biophysical research communications 20110311
Journal of medicinal chemistry 20110310
British journal of pharmacology 20101201
Histochemistry and cell biology 20101201
Journal of medicinal chemistry 20101014
The Journal of biological chemistry 20090320