AI68266
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $160.00 | $112.00 | - + | |
250mg | 95% | in stock | $319.00 | $224.00 | - + | |
500mg | 95% | in stock | $499.00 | $350.00 | - + | |
1g | 95% | in stock | $797.00 | $558.00 | - + | |
5g | 95% | in stock | $2,790.00 | $1,953.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI68266 |
Chemical Name: | (1R,2S)-Methyl 2-hydroxycyclopentanecarboxylate |
CAS Number: | 122331-02-6 |
Molecular Formula: | C7H12O3 |
Molecular Weight: | 144.16838 |
MDL Number: | MFCD18642815 |
SMILES: | COC(=O)[C@@H]1CCC[C@@H]1O |
(1R,2S)-Methyl 2-hydroxycyclopentanecarboxylate, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a valuable building block in organic synthesis due to its unique stereochemistry and functional groups. Its application in asymmetric synthesis is particularly noteworthy, where it acts as a chiral precursor for the preparation of biologically active molecules and pharmaceuticals.In chemical synthesis, (1R,2S)-Methyl 2-hydroxycyclopentanecarboxylate can be employed in the creation of complex molecules with specific stereochemical requirements. By utilizing its chiral properties, chemists can access enantiomerically pure compounds, which are crucial in the development of pharmaceuticals and agrochemicals. This compound can undergo various chemical transformations, such as functional group interconversions, oxidations, reductions, and cyclizations, expanding its utility in diverse synthetic pathways.Moreover, (1R,2S)-Methyl 2-hydroxycyclopentanecarboxylate can serve as a key intermediate in the synthesis of natural products, fine chemicals, and advanced materials. Its strategic incorporation into synthetic routes enables efficient access to structurally complex molecules with high optical purity, making it a valuable tool for chemists in the pursuit of novel synthetic methodologies and target-oriented synthesis.Overall, the application of (1R,2S)-Methyl 2-hydroxycyclopentanecarboxylate in chemical synthesis offers a powerful platform for the construction of stereochemically enriched compounds with diverse functionalities, making it an essential component in the toolkit of synthetic chemists.