logo
Home  > tert-Butyl 2-(6-bromo-2-oxo-3,4-dihydroquinolin-1(2h)-yl)acetate

AA55932

1224927-63-2 | tert-Butyl 2-(6-bromo-2-oxo-3,4-dihydroquinolin-1(2h)-yl)acetate

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $105.00 $74.00 -   +
5g 95% in stock $297.00 $208.00 -   +
10g 95% in stock $510.00 $357.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA55932
Chemical Name: tert-Butyl 2-(6-bromo-2-oxo-3,4-dihydroquinolin-1(2h)-yl)acetate
CAS Number: 1224927-63-2
Molecular Formula: C15H18BrNO3
Molecular Weight: 340.2123
MDL Number: MFCD26392965
SMILES: O=C(OC(C)(C)C)CN1C(=O)CCc2c1ccc(c2)Br

 

Computed Properties
Complexity: 391  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 20  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 4  
XLogP3: 2.8  

 

 

Upstream Synthesis Route 
  • tert-Butyl 2-(6-bromo-2-oxo-3,4-dihydroquinolin-1(2H)-yl)acetate is a versatile compound that finds applications in chemical synthesis, particularly in the field of medicinal chemistry and drug development. This compound serves as a valuable building block for the synthesis of various bioactive molecules and pharmaceutical intermediates. With its unique chemical structure, tert-Butyl 2-(6-bromo-2-oxo-3,4-dihydroquinolin-1(2H)-yl)acetate offers opportunities for creating novel compounds with potential therapeutic properties. Its ability to undergo various chemical transformations makes it a valuable tool in the synthesis of complex organic molecules for use in drug discovery and development.
FEATURED PRODUCTS