logo
Home  > Butanedioic acid, 2,3-diphenyl-, (2R,3S)-rel-

AA55972

1225-13-4 | Butanedioic acid, 2,3-diphenyl-, (2R,3S)-rel-

Packsize Purity Availability Price Discounted Price    Quantity
1g in stock $131.00 $92.00 -   +
5g in stock $386.00 $270.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA55972
Chemical Name: Butanedioic acid, 2,3-diphenyl-, (2R,3S)-rel-
CAS Number: 1225-13-4
Molecular Formula: C16H14O4
Molecular Weight: 270.28
MDL Number: MFCD00198082
SMILES: OC(=O)[C@H]([C@@H](c1ccccc1)C(=O)O)c1ccccc1

 

Upstream Synthesis Route 
  • The trans-2,3-Diphenylsuccinic acid is a versatile compound widely used in chemical synthesis due to its unique properties. This compound plays a crucial role in organic reactions and is commonly employed in the production of various pharmaceuticals, dyes, and advanced materials. Its ability to undergo selective functionalization reactions makes it a vital building block in the synthesis of complex organic molecules. Additionally, trans-2,3-Diphenylsuccinic acid is known for its high stability and compatibility with a wide range of reagents, making it a valuable tool for synthetic chemists seeking to create novel compounds with specific properties.
FEATURED PRODUCTS