1225-20-3 | sodium 3-(acetylamino)-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoate

Availability
Typically In Stock

Description

• Catalog Number: AE90531
• Chemical Name: sodium 3-(acetylamino)-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoate
• CAS Number: 1225-20-3
• Molecular Formula: C11H8I3N2NaO4
• Molecular Weight: 635.8954
• MDL Number: MFCD01717604
• SMILES: CNC(=O)c1c(I)c(NC(=O)C)c(c(c1I)C(=O)[O-])I.[Na+]

Upstream Synthesis Route

Iothalamate sodium, a derivative of diatrizoate, is a radiopaque contrast agent commonly used in medical imaging procedures such as angiography and computed tomography (CT) scans. However, beyond its diagnostic applications in medicine, Iothalamate sodium also plays a crucial role in chemical synthesis.In the realm of chemistry, Iothalamate sodium serves as a key reagent in the synthesis of various organic compounds. Its unique properties, such as its solubility in water and compatibility with aqueous solutions, make it a versatile tool in the laboratory. Chemists utilize Iothalamate sodium in reactions that require a contrast agent or a radiolabeled compound, particularly in the development of pharmaceuticals and other bioactive substances.Additionally, Iothalamate sodium's ability to form stable complexes with metal ions makes it valuable in coordination chemistry and catalytic processes. Its specific structure and properties allow for precise control over reaction conditions and facilitate the synthesis of complex molecules with high purity and efficiency.Overall, Iothalamate sodium's versatility and compatibility make it an indispensable component in chemical synthesis, enabling researchers to advance their understanding of molecular interactions and develop innovative materials and compounds for various applications in science and industry.