AT72578
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AT72578 |
Chemical Name: | 4-Dipropylsulfamoyl-benzamide |
CAS Number: | 122630-56-2 |
Molecular Formula: | C13H20N2O3S |
Molecular Weight: | 284.3745 |
SMILES: | CCCN(S(=O)(=O)c1ccc(cc1)C(=O)N)CCC |
In chemical synthesis, 4-(N,N-Dipropylsulfamoyl)benzamide is a versatile compound that serves as a crucial building block for creating various organic molecules. This compound is commonly used as a protecting group for primary amines during chemical reactions. By attaching this group to the amine functional group, it shields the amine from unwanted reactions or side products, allowing selective modifications of other parts of the molecule.Furthermore, 4-(N,N-Dipropylsulfamoyl)benzamide can also act as a directing group in transition metal-catalyzed reactions. This means that it can facilitate specific bond formations by coordinating with a metal catalyst, guiding the reaction towards a desired product. Additionally, this compound's sulfonamide moiety can participate in hydrogen bonding interactions, influencing the compound's reactivity and selectivity in various synthetic transformations.Overall, the application of 4-(N,N-Dipropylsulfamoyl)benzamide in chemical synthesis enables chemists to strategically manipulate the reactivity of functional groups and direct complex chemical reactions, leading to the efficient synthesis of target molecules with desired structures and properties.