AA56339
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 95% | in stock | $20.00 | $14.00 | - + | |
10mg | 95% | in stock | $28.00 | $19.00 | - + | |
50mg | 95% | in stock | $68.00 | $47.00 | - + | |
100mg | 95% | in stock | $105.00 | $73.00 | - + | |
250mg | 95% | in stock | $193.00 | $135.00 | - + | |
1g | 95% | in stock | $455.00 | $318.00 | - + | |
5g | 95% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA56339 |
Chemical Name: | Omarigliptin |
CAS Number: | 1226781-44-7 |
Molecular Formula: | C17H20F2N4O3S |
Molecular Weight: | 398.42750639999997 |
MDL Number: | MFCD22573261 |
SMILES: | Fc1ccc(c(c1)[C@H]1OC[C@@H](C[C@@H]1N)N1Cc2c(C1)cn(n2)S(=O)(=O)C)F |
Complexity: | 649 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.3 |
Journal of medicinal chemistry 20140424