AA56367
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $10.00 | $7.00 | - + | |
5g | 97% | in stock | $15.00 | $10.00 | - + | |
10g | 97% | in stock | $16.00 | $12.00 | - + | |
25g | 97% | in stock | $36.00 | $26.00 | - + | |
100g | 97% | in stock | $137.00 | $96.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA56367 |
Chemical Name: | 1-tert-Butyl 3-methyl pyrrolidine-1,3-dicarboxylate |
CAS Number: | 122684-33-7 |
Molecular Formula: | C11H19NO4 |
Molecular Weight: | 229.2729 |
MDL Number: | MFCD04038683 |
SMILES: | COC(=O)C1CCN(C1)C(=O)OC(C)(C)C |
Complexity: | 282 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.1 |
Methyl 1-Boc-3-pyrrolidinecarboxylate is a versatile compound widely used in chemical synthesis applications. As a key building block in organic chemistry, this compound plays a crucial role in the creation of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique chemical properties make it an ideal precursor for the modification of drug molecules, facilitating the development of new therapeutic agents with enhanced efficacy and reduced side effects. Additionally, Methyl 1-Boc-3-pyrrolidinecarboxylate is commonly employed in the synthesis of complex natural products and functional materials, enabling researchers to explore novel chemical structures and properties. Its compatibility with a wide range of reagents and reaction conditions makes it a valuable tool for organic chemists seeking to streamline their synthetic routes and optimize the efficiency of their processes. By incorporating Methyl 1-Boc-3-pyrrolidinecarboxylate into their chemical synthesis workflows, scientists can accelerate the discovery and development of innovative compounds with significant potential in various industries.