122684-65-5 | Isobutyraldehyde-D7

Availability
Typically In Stock

Description

• Catalog Number: AX33093
• Chemical Name: Isobutyraldehyde-D7
• CAS Number: 122684-65-5
• Molecular Formula: C4HD7O
• Molecular Weight: 79.1489
• SMILES: [2H]C(C(C([2H])([2H])[2H])(C=O)[2H])([2H])[2H]

Upstream Synthesis Route

Isobutyraldehyde-D7, a deuterated form of isobutyraldehyde, is a valuable chemical in the field of organic synthesis. Its unique isotopic composition, with deuterium atoms replacing hydrogen atoms, makes it particularly useful in various chemical reactions and studies.One of the key applications of Isobutyraldehyde-D7 is as a labeled compound in NMR spectroscopy. The presence of deuterium atoms in the molecule produces distinct signals in NMR spectra, allowing for precise identification and analysis of reaction mechanisms and intermediate species.Additionally, Isobutyraldehyde-D7 can be utilized as a stable isotope tracer in metabolic studies and kinetic investigations. By tracking the incorporation of deuterium into target molecules during a reaction, researchers can elucidate reaction pathways, identify reaction intermediates, and study the mechanisms of complex chemical transformations.In chemical synthesis, Isobutyraldehyde-D7 serves as a versatile building block for the preparation of deuterated compounds and isotopically labeled materials. Its selective deuterium substitution can alter the reactivity, selectivity, and properties of the resulting products, making it a valuable tool for designing and studying new chemical structures.Overall, Isobutyraldehyde-D7 plays a crucial role in advancing research in organic chemistry, medicinal chemistry, and materials science, offering unique insights into molecular transformations and providing a platform for the development of innovative synthetic methods.