122752-21-0 | Mycalolide B

Availability
Typically In Stock

Description

• Catalog Number: AD58432
• Chemical Name: Mycalolide B
• CAS Number: 122752-21-0
• Molecular Formula: C28H33N3O6
• Molecular Weight: 507.5781
• MDL Number: MFCD00272618
• SMILES: CCCC1OC(=O)CCCC=CC(=O)CCc2coc(-c3nc(-c4nc(C=CCCC1C)oc4)oc3)n2

Upstream Synthesis Route

Mycalolide B is a naturally occurring compound that has shown significant potential in the field of chemical synthesis. This marine natural product has gained attention for its unique structure and diverse range of applications in organic chemistry. In chemical synthesis, Mycalolide B serves as a valuable building block for the creation of complex molecules due to its intricate and versatile chemical structure. Researchers have harnessed its reactive functional groups to facilitate the formation of new carbon-carbon and carbon-oxygen bonds in a controlled manner, enabling the efficient construction of intricate molecular frameworks. Furthermore, the robust nature of Mycalolide B makes it a valuable tool for the development of novel synthetic methodologies and the generation of structurally diverse compounds with potential pharmaceutical or material science applications. Its role in chemical synthesis highlights the importance of natural products in inspiring innovative approaches to modern organic chemistry.