1227574-73-3 | Methyl 2-amino-4-(trifluoromethyl)nicotinate

Availability
Typically In Stock

Description

• Catalog Number: BD73658
• Chemical Name: Methyl 2-amino-4-(trifluoromethyl)nicotinate
• CAS Number: 1227574-73-3
• Molecular Formula: C8H7F3N2O2
• Molecular Weight: 220.1486
• SMILES: COC(=O)c1c(N)nccc1C(F)(F)F

Upstream Synthesis Route

Methyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate is a versatile compound that plays a crucial role in chemical synthesis processes. Its unique chemical structure, characterized by the presence of an amino group, a trifluoromethyl group, and a pyridine ring, imparts distinct properties that make it valuable in various synthetic applications.One of the key applications of Methyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate is as a building block in the synthesis of pharmaceutical compounds. The presence of the amino group allows for facile functionalization, enabling the attachment of different functional groups to modulate the biological activity of the target molecule. Additionally, the trifluoromethyl group enhances the lipophilicity and metabolic stability of the resulting compounds, making them more suitable for drug development. The pyridine ring, a common motif in many bioactive molecules, further expands the potential applications of this compound in medicinal chemistry.Furthermore, Methyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate can also be employed in the preparation of agrochemicals, dyes, and materials with specific electronic properties. Its versatile reactivity and compatibility with various synthetic methodologies make it a valuable building block for organic chemists seeking to create novel compounds with tailored properties for a wide range of applications.