1227581-78-3 | 2-Nitro-3-(trifluoromethyl)benzoic acid

Availability
Typically In Stock

Description

• Catalog Number: AA24888
• Chemical Name: 2-Nitro-3-(trifluoromethyl)benzoic acid
• CAS Number: 1227581-78-3
• Molecular Formula: C8H4F3NO4
• Molecular Weight: 235.1169
• MDL Number: MFCD16606324
• SMILES: OC(=O)c1cccc(c1[N+](=O)[O-])C(F)(F)F

Upstream Synthesis Route

2-Nitro-3-(trifluoromethyl)benzoic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. In organic chemistry, this compound serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique trifluoromethyl group imparts valuable properties to the final products, making it an essential component in many synthesis routes. Additionally, 2-Nitro-3-(trifluoromethyl)benzoic acid is commonly employed as a reagent in the preparation of complex molecules with diverse functionalities. Its strategic placement in synthetic schemes allows for efficient and selective transformations, facilitating the creation of novel compounds with desired properties. This compound plays a crucial role in modern chemical synthesis, enabling the development of innovative materials and compounds for various applications.