AE35984
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $42.00 | $29.00 | - + | |
5mg | 98% | in stock | $160.00 | $112.00 | - + | |
25mg | 95% | in stock | $206.00 | $144.00 | - + | |
50mg | 98% | in stock | $231.00 | $162.00 | - + | |
100mg | 98% | in stock | $367.00 | $257.00 | - + | |
250mg | 95% | in stock | $749.00 | $524.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35984 |
Chemical Name: | Siponimod |
CAS Number: | 1230487-00-9 |
Molecular Formula: | C29H35F3N2O3 |
Molecular Weight: | 516.5950 |
MDL Number: | MFCD26142651 |
SMILES: | CCc1cc(ccc1CN1CC(C1)C(=O)O)C(=NOCc1ccc(c(c1)C(F)(F)F)C1CCCCC1)C |
Complexity: | 777 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 37 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 9 |
XLogP3: | 4.8 |
Archives of toxicology 20180101
Journal of neuroinflammation 20160101
Journal of neuroinflammation 20160101
Bioorganic & medicinal chemistry letters 20131201
ACS medicinal chemistry letters 20130314
British journal of pharmacology 20121101